
943-03-3
| Name | 2-Cyano-6-methoxybenzothiazole |
| CAS | 943-03-3 |
| EINECS(EC#) | 231-439-8 |
| Molecular Formula | C9H6N2OS |
| MDL Number | MFCD00010537 |
| Molecular Weight | 190.22 |
| MOL File | 943-03-3.mol |
Chemical Properties
| Appearance | off-white to light yellow crystalline powder |
| Melting point | 129-131 °C (lit.) |
| Boiling point | 334.9±34.0 °C(Predicted) |
| density | 1.2938 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: soluble5%, clear, colorless to faintly yellow |
| form | Crystalline Powder |
| pka | -1.49±0.10(Predicted) |
| color | Off-white to light yellow |
| InChI | InChI=1S/C9H6N2OS/c1-12-6-2-3-7-8(4-6)13-9(5-10)11-7/h2-4H,1H3 |
| InChIKey | DEWDWBYQOFXKIH-UHFFFAOYSA-N |
| SMILES | S1C2=CC(OC)=CC=C2N=C1C#N |
| CAS DataBase Reference | 943-03-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
