9016-87-9
| Name | Polymethylene polyphenyl polyisocyanate |
| CAS | 9016-87-9 |
| EINECS(EC#) | 922-627-7 |
| Molecular Formula | [C6H3(NCO)CH2]n |
| MDL Number | MFCD00072953 |
| Molecular Weight | 149.147 |
| MOL File | 9016-87-9.mol |
Chemical Properties
| Definition | A polymer of diphenylmethane-4,4′-diisocyanate. |
| Appearance | liquid |
| Boiling point | 392 °C5 mm Hg |
| density | 1.2 g/mL at 25 °C(lit.) |
| vapor density | 8.6 (vs air) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Refrigerator, Under inert atmosphere |
| solubility | DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol (Soluble) |
| form | Oil |
| color | Yellow to Orange |
| Stability: | Stable. Incompatible with strong oxidizing agents, alcohols. May decompose in moist air, or on contact with water. |
| Specific Activity | ~3.2isocyanate groups/molecule |
| InChI | InChI=1S/C7H5NO.CH2O/c9-6-8-7-4-2-1-3-5-7;1-2/h1-5H;1H2 |
| InChIKey | JTEOXXUIKUHXLD-UHFFFAOYSA-N |
| SMILES | O=C=NC1C([H])=C([H])C([H])=C([H])C=1[H].O=C([H])[H] |
| IARC | 3 (Vol. 19, Sup 7) 1987 |
| EPA Substance Registry System | Isocyanic acid, polymethylenepolyphenylene ester(9016-87-9) |
Safety Data
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H317-H319-H330-H334-H335-H351-H373 |
| Precautionary statements | P202-P260-P280-P302+P352-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn,T+,T,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | TR0350000 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Carc. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 Inhalation STOT SE 3 |
| Safety Profile | |
| Hazardous Substances Data | 9016-87-9(Hazardous Substances Data) |