
88-58-4
| Name | 2,5-Di-tert-butylhydroquinone |
| CAS | 88-58-4 |
| EINECS(EC#) | 201-841-8 |
| Molecular Formula | C14H22O2 |
| MDL Number | MFCD00008825 |
| Molecular Weight | 222.32 |
| MOL File | 88-58-4.mol |
Chemical Properties
| Appearance | cream or pale brown solid |
| Melting point | 216-218 °C(lit.) |
| Boiling point | 321°C |
| density | 1,07 g/cm3 |
| refractive index | 1.4576 (estimate) |
| Fp | 216 °C |
| storage temp. | Store below +30°C. |
| solubility | almost transparency in Methanol |
| form | Crystalline Powder |
| pka | 11.89±0.23(Predicted) |
| color | Light beige to pink-beige |
| Stability: | Stable. Incompatible with oxidizing agents. |
| Water Solubility | 3.8mg/L at 20℃ |
| BRN | 2049542 |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| Cosmetic Ingredient Review (CIR) | 2,5-Di-tert-butylhydroquinone (88-58-4) |
| InChI | 1S/C14H22O2/c1-13(2,3)9-7-12(16)10(8-11(9)15)14(4,5)6/h7-8,15-16H,1-6H3 |
| InChIKey | JZODKRWQWUWGCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(O)c(cc1O)C(C)(C)C |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H317-H335-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P310-P302+P352 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | MX5160000 |
| Autoignition Temperature | 790 °F |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29072900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT SE 3 |

