
84-51-5
| Name | 2-Ethyl anthraquinone |
| CAS | 84-51-5 |
| EINECS(EC#) | 201-535-4 |
| Molecular Formula | C16H12O2 |
| MDL Number | MFCD00001237 |
| Molecular Weight | 236.27 |
| MOL File | 84-51-5.mol |
Chemical Properties
| Appearance | white or yellowish crystals or powder |
| Melting point | 108-111 °C (lit.) |
| Boiling point | 180-190°C |
| bulk density | 650kg/m3 |
| density | 1.27 g/cm3 (21℃) |
| vapor pressure | <1 hPa (25 °C) |
| refractive index | 1.6290 (estimate) |
| Fp | >210°C |
| storage temp. | Store below +30°C. |
| solubility | 0.00025g/l |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | Insoluble in water. |
| BRN | 1969873 |
| Henry's Law Constant | 2.6×101 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) |
| InChI | 1S/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
| InChIKey | SJEBAWHUJDUKQK-UHFFFAOYSA-N |
| SMILES | CCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H373-H410 |
| Precautionary statements | P260-P273-P314-P391-P501 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 1 |
| RTECS | CB0525000 |
| Autoignition Temperature | 485 °C |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 Oral |
| Toxicity |

