
81721-87-1
| Name | 6-NITRO-2H-1,4-BENZOXAZIN-3(4H)-ONE |
| CAS | 81721-87-1 |
| Molecular Formula | C8H6N2O4 |
| MDL Number | MFCD03425744 |
| Molecular Weight | 194.14 |
| MOL File | 81721-87-1.mol |
Chemical Properties
| Melting point | 236-240 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | 1S/C8H6N2O4/c11-8-4-14-7-2-1-5(10(12)13)3-6(7)9-8/h1-3H,4H2,(H,9,11) |
| InChIKey | UNYXDJBNODSRRC-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2OCC(=O)Nc2c1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
