
79622-59-6
| Name | Fluazinam |
| CAS | 79622-59-6 |
| EINECS(EC#) | 200-835-2 |
| Molecular Formula | C13H4Cl2F6N4O4 |
| MDL Number | MFCD00214168 |
| Molecular Weight | 465.09 |
| MOL File | 79622-59-6.mol |
Chemical Properties
| Melting point | 100-102° |
| Boiling point | 376.1±42.0 °C(Predicted) |
| density | 1.766±0.06 g/cm3(Predicted) |
| vapor pressure | 1.5 x 10-3 Pa (25 °C) |
| Fp | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF:25.0(Max Conc. mg/mL);53.75(Max Conc. mM) DMSO:25.0(Max Conc. mg/mL);53.75(Max Conc. mM) Ethanol:15.0(Max Conc. mg/mL);32.25(Max Conc. mM) PBS (pH: 7.2):0.25(Max Conc. mg/mL);0.54(Max Conc. mM) |
| form | neat |
| pka | 7.11(at 25℃) |
| Water Solubility | 1.7 mg l-1 (25 °C) |
| color | Light yellow to Amber to Dark green |
| Merck | 14,4117 |
| BRN | 4772672 |
| Henry's Law Constant | 3.9×10-2 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | 1S/C13H4Cl2F6N4O4/c14-6-1-4(12(16,17)18)3-22-11(6)23-9-7(24(26)27)2-5(13(19,20)21)8(15)10(9)25(28)29/h1-3H,(H,22,23) |
| Contact allergens | |
| InChIKey | UZCGKGPEKUCDTF-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(c(Cl)c(c1Nc2ncc(cc2Cl)C(F)(F)F)[N+]([O-])=O)C(F)(F)F |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H318-H332-H361d-H410 |
| Precautionary statements | P273-P280-P302+P352-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | T;N,N,T,Xn,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | UR8085000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Repr. 2 Skin Sens. 1 |
| Safety Profile | |
| Hazardous Substances Data | 79622-59-6(Hazardous Substances Data) |



