
7499-08-3
| Name | 3-Chloro-2-methylbenzoic acid |
| CAS | 7499-08-3 |
| EINECS(EC#) | 626-731-0 |
| Molecular Formula | C8H7ClO2 |
| MDL Number | MFCD00053312 |
| Molecular Weight | 170.59 |
| MOL File | 7499-08-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 163-166 °C (lit.) |
| Boiling point | 290.9±20.0 °C(Predicted) |
| density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1072826 |
| InChI | InChI=1S/C8H7ClO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11) |
| InChIKey | HXGHMCLCSPQMOR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Cl)=C1C |
| CAS DataBase Reference | 7499-08-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | XU1645000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
