7397-46-8
| Name | Methoxydiethylborane |
| CAS | 7397-46-8 |
| EINECS(EC#) | -0 |
| Molecular Formula | C5H13BO |
| MDL Number | MFCD00013240 |
| Molecular Weight | 99.97 |
| MOL File | 7397-46-8.mol |
Chemical Properties
| Boiling point | 89-90 °C |
| density | 0.868 g/mL at 25 °C |
| refractive index | n |
| RTECS | ED6151000 |
| Fp | 20 °F |
| form | Solution |
| color | Clear colorless to slightly amber |
| Sensitive | Moisture Sensitive |
| BRN | 2231225 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | InChI=1S/C5H13BO/c1-4-6(5-2)7-3/h4-5H2,1-3H3 |
| InChIKey | FESAXEDIWWXCNG-UHFFFAOYSA-N |
| SMILES | B(OC)(CC)CC |
| CAS DataBase Reference | 7397-46-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethylmethoxyborane(7397-46-8) |
| Storage Precautions | Store under nitrogen |
| EPA Substance Registry System | 7397-46-8(EPA Substance) |
Safety Data
| Symbol(GHS) |     GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H250-H302+H312+H332-H314-H317-H373-H413 |
| Precautionary statements | P231+P232-P273-P280-P303+P361+P353-P305+P351+P338-P370+P378 |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 2 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Flam. Liq. 2 Pyr. Liq. 1 Skin Corr. 1B Skin Sens. 1 STOT RE 2 STOT SE 3 |