72963-72-5
| Name | Imiprothrin |
| CAS | 72963-72-5 |
| EINECS(EC#) | 428-790-6 |
| Molecular Formula | C17H22N2O4 |
| MDL Number | MFCD03703407 |
| Molecular Weight | 318.4 |
| MOL File | 72963-72-5.mol |
Chemical Properties
| Melting point | <25 °C |
| Boiling point | 403.1±55.0 °C(Predicted) |
| density | 0.979 |
| vapor pressure | 0-0Pa at 20-40℃ |
| Fp | 110°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | neat |
| pka | -2.34±0.20(Predicted) |
| color | White to Off-White Waxy |
| Henry's Law Constant | 1.6×105 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Major Application | agriculture environmental |
| InChI | 1S/C17H22N2O4/c1-6-7-18-9-13(20)19(16(18)22)10-23-15(21)14-12(8-11(2)3)17(14,4)5/h1,8,12,14H,7,9-10H2,2-5H3 |
| InChIKey | VPRAQYXPZIFIOH-UHFFFAOYSA-N |
| SMILES | C\C(C)=C/C1C(C(=O)OCN2C(=O)CN(CC#C)C2=O)C1(C)C |
| LogP | 2.32 at 25℃ and pH5.4 |
| Surface tension | 53.9mN/m at 86mg/L and 20℃ |
| CAS DataBase Reference | 72963-72-5(CAS DataBase Reference) |
| EPA Substance Registry System | 72963-72-5(EPA Substance) |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 2 |
| REACH Registrations | Active |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 STOT SE 2 |
| Hazardous Substances Data | 72963-72-5(Hazardous Substances Data) |