72088-94-9
| Name | 5(6)-Carboxyfluorescein |
| CAS | 72088-94-9 |
| EINECS(EC#) | 276-331-1 |
| Molecular Formula | C42H24O14 |
| MDL Number | MFCD00151081 |
| Molecular Weight | 752.63 |
| MOL File | 72088-94-9.mol |
Chemical Properties
| Appearance | Dark-Orange to Brown Solid |
| Melting point | 275 °C |
| Boiling point | 464.9°C (rough estimate) |
| density | 1.3418 (rough estimate) |
| refractive index | 1.6380 (estimate) |
| storage temp. | Store at 2-8 |
| solubility | DMSO (Sparingly), Methanol (Slightly, Heated) |
| form | Solid |
| color | Light Yellow to Dark Brown |
| Water Solubility | slightly soluble |
| ε(extinction coefficient) | 12134 at 284nm in 0.1 M NaOH at 0.005g/L 43060 at 239nm in 0.1 M NaOH at 0.005g/L |
| λmax | 492 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | CPRVUBZYHZGASQ-UHFFFAOYSA-N |
| SMILES | C12(OC(=O)C3C=CC(C(=O)O)=CC1=3)C1=CC=C(O)C=C1OC1C=C(O)C=CC2=1.C12(OC(=O)C3C=C(C(=O)O)C=CC1=3)C1=CC=C(O)C=C1OC1C=C(O)C=CC2=1 |
| EPA Substance Registry System | Spiro[isobenzofuran- 1(3H),9'-[9H]xanthene]- ar-carboxylic acid, 3',6'-dihydroxy- 3-oxo-(72088-94-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |