69571-02-4
| Name | 4,4'-Diiodo-2,2'-dimethylbiphenyl |
| CAS | 69571-02-4 |
| EINECS(EC#) | 804-250-9 |
| Molecular Formula | C14H12I2 |
| MDL Number | MFCD13185944 |
| Molecular Weight | 434.05 |
| MOL File | 69571-02-4.mol |
Chemical Properties
| Melting point | 96.0 to 100.0 °C |
| Boiling point | 374.8±42.0 °C(Predicted) |
| density | 1.875 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C14H12I2/c1-9-7-11(15)3-5-13(9)14-6-4-12(16)8-10(14)2/h3-8H,1-2H3 |
| InChIKey | WHFMNDMHTIOIMS-UHFFFAOYSA-N |
| SMILES | Cc1cc(I)ccc1-c2ccc(I)cc2C |
Safety Data
| Symbol(GHS) |   GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H318-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3152PSN1 9 / PGII |
| WGK Germany | 3 |
| HS Code | 2903.99.8001 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |