6945-67-1
| Name | 2-Bromo-4-nitropyridine |
| CAS | 6945-67-1 |
| Molecular Formula | C5H3BrN2O2 |
| MDL Number | MFCD03701383 |
| Molecular Weight | 202.99 |
| MOL File | 6945-67-1.mol |
Chemical Properties
| Melting point | 64℃ |
| Boiling point | 286.1±20.0 °C(Predicted) |
| density | 1.833±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -3.12±0.10(Predicted) |
| color | Light yellow to Yellow to Green |
| BRN | 120826 |
| InChI | InChI=1S/C5H3BrN2O2/c6-5-3-4(8(9)10)1-2-7-5/h1-3H |
| InChIKey | AFVITJKRFRRQKT-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 6945-67-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
