573675-25-9
| Name | 5-Bromo-3-nitropyridine-2-carbonitrile |
| CAS | 573675-25-9 |
| EINECS(EC#) | 629-442-8 |
| Molecular Formula | C6H2BrN3O2 |
| MDL Number | MFCD06657551 |
| Molecular Weight | 228 |
| MOL File | 573675-25-9.mol |
Chemical Properties
| Appearance | Yellow to light yellow crystals |
| Melting point | 101-106 °C |
| Boiling point | 348.9±42.0 °C(Predicted) |
| density | 1.92±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -6.71±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C6H2BrN3O2/c7-4-1-6(10(11)12)5(2-8)9-3-4/h1,3H |
| InChIKey | OBVYONPVHIOJJZ-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 573675-25-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H315-H318-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
