298709-29-2
| Name | 2-Cyano-3,5-difluoropyridine |
| CAS | 298709-29-2 |
| EINECS(EC#) | 678-766-6 |
| Molecular Formula | C6H2F2N2 |
| MDL Number | MFCD03788759 |
| Molecular Weight | 140.09 |
| MOL File | 298709-29-2.mol |
Chemical Properties
| Melting point | 32-34°C |
| Boiling point | 187.8±35.0 °C(Predicted) |
| density | 1.36±0.1 g/cm3(Predicted) |
| Fp | 90℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -5.16±0.20(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C6H2F2N2/c7-4-1-5(8)6(2-9)10-3-4/h1,3H |
| InChIKey | WLBIFECTHKFYKV-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(F)C=C1F |
| CAS DataBase Reference | 298709-29-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |