66916-99-2
| Name | 2-Bromo-4-methoxyphenylacetic acid |
| CAS | 66916-99-2 |
| Molecular Formula | C9H9BrO3 |
| MDL Number | MFCD02664700 |
| Molecular Weight | 245.07 |
| MOL File | 66916-99-2.mol |
Chemical Properties
| Melting point | 127-131 °C (lit.) |
| Boiling point | 353.6±27.0 °C(Predicted) |
| density | 1.560±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 4.20±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H9BrO3/c1-13-7-3-2-6(4-9(11)12)8(10)5-7/h2-3,5H,4H2,1H3,(H,11,12) |
| InChIKey | XQELSBAAFMYSMG-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(OC)C=C1Br |
| CAS DataBase Reference | 66916-99-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29189900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |