6627-55-0
| Name | 2-Bromo-4-methylphenol |
| CAS | 6627-55-0 |
| EINECS(EC#) | 229-595-7 |
| Molecular Formula | C7H7BrO |
| MDL Number | MFCD00002151 |
| Molecular Weight | 187.03 |
| MOL File | 6627-55-0.mol |
Chemical Properties
| Appearance | clear colourless to pale yellow liquid |
| Melting point | 54-55 °C |
| Boiling point | 245-247 °C |
| density | 1.547 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Chloroform, Methanol |
| form | powder to lump to clear liquid |
| pka | 8.73±0.18(Predicted) |
| color | White or Colorless to Light yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H7BrO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3 |
| InChIKey | MTIDYGLTAOZOGU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C=C1Br |
| CAS DataBase Reference | 6627-55-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 2-bromo-4-methyl-(6627-55-0) |
| EPA Substance Registry System | Phenol, 2-bromo-4-methyl- (6627-55-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | GO6868200 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29071990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
