
65873-72-5
| Name | 6-Methoxynicotinaldehyde |
| CAS | 65873-72-5 |
| EINECS(EC#) | 627-354-4 |
| Molecular Formula | C7H7NO2 |
| MDL Number | MFCD02683446 |
| Molecular Weight | 137.14 |
| MOL File | 65873-72-5.mol |
Chemical Properties
| Appearance | off-white to light yellow crystalline powder |
| Melting point | 51-54 °C (lit.) |
| Boiling point | 65-70 °C(Press: 12 Torr) |
| density | 1.159±0.06 g/cm3(Predicted) |
| Fp | 225 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Crystalline Powder |
| pka | 1.60±0.10(Predicted) |
| color | Off-white to light yellow |
| Water Solubility | insoluble |
| Detection Methods | HPLC |
| InChI | InChI=1S/C7H7NO2/c1-10-7-3-2-6(5-9)4-8-7/h2-5H,1H3 |
| InChIKey | CTAIEPPAOULMFY-UHFFFAOYSA-N |
| SMILES | C1=NC(OC)=CC=C1C=O |
| CAS DataBase Reference | 65873-72-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
