
652-36-8
| Name | Tetrafluoroterephthalic acid |
| CAS | 652-36-8 |
| EINECS(EC#) | 211-489-7 |
| Molecular Formula | C8H2F4O4 |
| MDL Number | MFCD00012301 |
| Molecular Weight | 238.09 |
| MOL File | 652-36-8.mol |
Chemical Properties
| Melting point | 275-277 °C (dec.)(lit.) |
| Boiling point | 337.9±42.0 °C(Predicted) |
| density | 1.812±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | very faint turbidity in hot Water |
| form | powder to crystal |
| pka | 0.95±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C8H2F4O4/c9-3-1(7(13)14)4(10)6(12)2(5(3)11)8(15)16/h(H,13,14)(H,15,16) |
| InChIKey | WFNRNCNCXRGUKN-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C(F)C(F)=C(C(O)=O)C(F)=C1F |
| CAS DataBase Reference | 652-36-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Terephthalic acid, tetrafluoro-(652-36-8) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | CORROSIVE |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
