64924-67-0
| Name | Halofuginone hydrobromide |
| CAS | 64924-67-0 |
| Molecular Formula | C16H17BrClN3O3.HBr |
| MDL Number | MFCD23843776 |
| Molecular Weight | 495.59 |
| MOL File | 64924-67-0.mol |
Chemical Properties
| Melting point | 247° (dec) |
| storage temp. | Store at -20°C |
| solubility | Soluble to 100 mM in DMSO. |
| form | neat |
| color | White to off-white |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1/C16H17BrClN3O3.BrH/c17-11-6-13-10(5-12(11)18)16(24)21(8-20-13)7-9(22)4-14-15(23)2-1-3-19-14;/h5-6,8,14-15,19,23H,1-4,7H2;1H/t14-,15+;/s3 |
| InChIKey | SJUWEPZBTXEUMU-DWKGARMTNA-N |
| SMILES | C12C=C(C(Br)=CC=1N=CN(CC(=O)C[C@@H]1NCCC[C@H]1O)C2=O)Cl.Br |&1:14,19,r| |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H315-H319-H410 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| RIDADR | UN2811 - class 6.1 - PG 1 - EHS - Toxic solids, organic, n.o.s., HI: all |
| WGK Germany | 3 |
| RTECS | VA2397066 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |