63503-60-6
| Name | 3-Chlorophenylboronic acid |
| CAS | 63503-60-6 |
| EINECS(EC#) | 628-786-6 |
| Molecular Formula | C6H6BClO2 |
| MDL Number | MFCD00161354 |
| Molecular Weight | 156.37 |
| MOL File | 63503-60-6.mol |
Chemical Properties
| Appearance | white to light yellow-green crystalline powder or |
| Melting point | 185-189 °C(lit.) |
| Boiling point | 311.4±44.0 °C(Predicted) |
| density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder or Needles |
| pka | 7.55±0.10(Predicted) |
| color | White to light yellow-green |
| Water Solubility | Slightly soluble in water. soluble in ether, tetrahydrofuran,, dimethyl sulfoxide, dimethyl formamide, methanol. |
| BRN | 2936343 |
| InChI | InChI=1S/C6H6BClO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H |
| InChIKey | SDEAGACSNFSZCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(Cl)=C1)(O)O |
| CAS DataBase Reference | 63503-60-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |