6329-61-9
| Name | Decahydroisoquinoline |
| CAS | 6329-61-9 |
| EINECS(EC#) | 228-702-4 |
| Molecular Formula | C9H17N |
| MDL Number | MFCD00012096 |
| Molecular Weight | 139.24 |
| MOL File | 6329-61-9.mol |
Chemical Properties
| Melting point | 180 °C |
| Boiling point | 211-214 °C(lit.) |
| density | 0.936 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 175 °F |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| form | clear liquid |
| pka | 11.84±0.20(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C9H17N/c1-2-4-9-7-10-6-5-8(9)3-1/h8-10H,1-7H2 |
| InChIKey | NENLYAQPNATJSU-UHFFFAOYSA-N |
| SMILES | C1C2C(CCCC2)CCN1 |
| CAS DataBase Reference | 6329-61-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933.49.7000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |