6311-37-1
| Name | 4-AMINO-3-BROMOBENZOIC ACID |
| CAS | 6311-37-1 |
| Molecular Formula | C7H6BrNO2 |
| MDL Number | MFCD03407439 |
| Molecular Weight | 216.03 |
| MOL File | 6311-37-1.mol |
Chemical Properties
| Appearance | White to light yellow crystal powder |
| Melting point | 211-215 °C |
| Boiling point | 368.5±32.0 °C(Predicted) |
| density | 1.793±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 4.47±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6BrNO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,9H2,(H,10,11) |
| InChIKey | BFIVZIVVJNFTIQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(Br)=C1 |
| CAS DataBase Reference | 6311-37-1(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29224999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
