20776-51-6
| Name | 2-AMINO-3-BROMOBENZOIC ACID |
| CAS | 20776-51-6 |
| EINECS(EC#) | 630-294-1 |
| Molecular Formula | C7H6BrNO2 |
| MDL Number | MFCD03618453 |
| Molecular Weight | 216.03 |
| MOL File | 20776-51-6.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 173 °C |
| Boiling point | 343.5±32.0 °C(Predicted) |
| density | 1.793±0.06 g/cm3(Predicted) |
| Fp | 161°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 4.55±0.10(Predicted) |
| color | White to pale yellow |
| λmax | 323nm(Phosphate buffer sol.)(lit.) |
| InChI | InChI=1S/C7H6BrNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | SRIZNTFPBWRGPB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Br)=C1N |
| CAS DataBase Reference | 20776-51-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2922498590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
