
6231-18-1
| Name | 2,6-Dimethoxypyridine |
| CAS | 6231-18-1 |
| EINECS(EC#) | 228-334-4 |
| Molecular Formula | C7H9NO2 |
| MDL Number | MFCD00006266 |
| Molecular Weight | 139.15 |
| MOL File | 6231-18-1.mol |
Chemical Properties
| Appearance | clear colorless to light yellow liquid |
| Boiling point | 178-180 °C (lit.) |
| density | 1.053 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 143 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 1.57±0.10(Predicted) |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.053 |
| BRN | 1525332 |
| InChI | InChI=1S/C7H9NO2/c1-9-6-4-3-5-7(8-6)10-2/h3-5H,1-2H3 |
| InChIKey | IBTGEEMBZJBBSH-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC(OC)=CC=C1 |
| CAS DataBase Reference | 6231-18-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 2,6-dimethoxy-(6231-18-1) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |