61699-62-5
| Name | 3,4-Diisopropoxy-3-cyclobutene-1,2-dione |
| CAS | 61699-62-5 |
| Molecular Formula | C10H14O4 |
| MDL Number | MFCD00075125 |
| Molecular Weight | 198.22 |
| MOL File | 61699-62-5.mol |
Chemical Properties
| Melting point | 43-45 °C (lit.) |
| Boiling point | 110 °C/0.04 mmHg (lit.) |
| density | 1.1825 (rough estimate) |
| refractive index | 1.5439 (estimate) |
| Fp | >230 °F |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C10H14O4/c1-5(2)13-9-7(11)8(12)10(9)14-6(3)4/h5-6H,1-4H3 |
| InChIKey | KCZPGGVPQXQGEJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(OC(C)C)C(=O)C1=O |
| CAS DataBase Reference | 61699-62-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |