6152-67-6
| Name | Sodium diphenylamine-4-sulfonate |
| CAS | 6152-67-6 |
| EINECS(EC#) | 228-165-6 |
| Molecular Formula | C12H10NNaO3S |
| MDL Number | MFCD00036468 |
| Molecular Weight | 271.27 |
| MOL File | 6152-67-6.mol |
Chemical Properties
| Appearance | off-white powder |
| Melting point | >300 C |
| bulk density | 160kg/m3 |
| storage temp. | Store at +15°C to +25°C. |
| solubility | 820g/l |
| form | Crystalline Powder |
| color | Off-white to beige or light gray |
| Odor | Characteristic odour |
| PH | 5.7 (10g/l, H2O, 20℃) |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids. |
| Water Solubility | soluble |
| InChI | InChI=1S/C12H11NO3S.Na.H/c14-17(15,16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10;;/h1-9,13H,(H,14,15,16);; |
| InChIKey | DGXTZMPQSMIFEC-UHFFFAOYSA-M |
| SMILES | N(C1C=CC=CC=1)C1C=CC(S(O)(=O)=O)=CC=1.[NaH] |
| CAS DataBase Reference | 6152-67-6(CAS DataBase Reference) |
| EPA Substance Registry System | 6152-67-6(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29214400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |