| Melting point |
56°; mp (racemate) 39-40° (Danishevsky, Dumas); mp 46-47° (Mirrington, Schmalzl) |
| alpha |
D20 -97.4° (c = 24 in chloroform) |
| Boiling point |
bp8 140° |
| density |
d420 1.0284 |
| vapor pressure |
0.14Pa at 24℃ |
| refractive index |
nD65 1.5029 |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Sparingly), Methanol (Slightly) |
| form |
Solid |
| pka |
15.23±0.70(Predicted) |
| color |
White to Off-White |
| Odor |
at 100.00 %. patchouli earthy camphor powdery |
| Odor Type |
woody |
| Water Solubility |
41.8mg/L at 24℃ |
| Henry's Law Constant |
1.3×101 mol/(m3Pa) at 25℃, Dupeux et al. (2022) |
| Major Application |
food and beverages |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C15H26O/c1-10-5-8-15(16)13(2,3)11-6-7-14(15,4)12(10)9-11/h10-12,16H,5-9H2,1-4H3/t10-,11,12,14-,15/m0/s1 |
| InChIKey |
GGHMUJBZYLPWFD-DUNKBJDJSA-N |
| SMILES |
CC1(C)[C@@H]2CC[C@]3(C)[C@@]1(O)CC[C@H](C)[C@@H]3C2 |
| LogP |
5.5 at 25℃ |
| NIST Chemistry Reference |
Patchouli alcohol(5986-55-0) |
| EPA Substance Registry System |
1,6-Methanonaphthalen- 1(2H)-ol, octahydro-4,8a,9,9-tetramethyl-, (1R,4S,4aS,6R,8aS)-(5986-55-0) |
