
588-93-2
| Name | 1-Bromo-4-propylbenzene |
| CAS | 588-93-2 |
| EINECS(EC#) | 454-790-0 |
| Molecular Formula | C9H11Br |
| MDL Number | MFCD00012456 |
| Molecular Weight | 199.09 |
| MOL File | 588-93-2.mol |
Chemical Properties
| Appearance | Clear colorless to slightly yellow liquid |
| Melting point | -41.4°C |
| Boiling point | 225 °C(lit.) |
| density | 1.286 g/mL at 25 °C(lit.) |
| vapor pressure | 4.7Pa at 25℃ |
| refractive index | n |
| Fp | 203 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Specific Gravity | 1.286 |
| Water Solubility | 2.867mg/L at 20℃ |
| Usage | Intermediates of Liquid Crystals |
| InChI | InChI=1S/C9H11Br/c1-2-3-8-4-6-9(10)7-5-8/h4-7H,2-3H2,1H3 |
| InChIKey | NUPWGLKBGVNSJX-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(CCC)C=C1 |
| LogP | 4.9 at 25℃ |
| CAS DataBase Reference | 588-93-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H315-H318-H410 |
| Precautionary statements | P264-P273-P280-P302+P352-P305+P351+P338-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 |

