
586-35-6
| Name | 2-Bromoterephthalic acid |
| CAS | 586-35-6 |
| EINECS(EC#) | 209-572-8 |
| Molecular Formula | C8H5BrO4 |
| MDL Number | MFCD00002403 |
| Molecular Weight | 245.03 |
| MOL File | 586-35-6.mol |
Chemical Properties
| Appearance | white crystalline powder |
| Melting point | 295-297 °C(lit.) |
| Boiling point | 421.6±40.0 °C(Predicted) |
| density | 1.8281 (rough estimate) |
| refractive index | 1.4490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.44±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Soluble in water. |
| BRN | 2616163 |
| InChI | InChI=1S/C8H5BrO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(C(O)=O)C=C1Br |
| CAS DataBase Reference | 586-35-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T,C,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 6.1 |
| HS Code | 29173919 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
