
56602-33-6
| Name | Benzotriazol-1-yloxytris(dimethylamino)-phosphonium hexafluorophosphate |
| CAS | 56602-33-6 |
| EINECS(EC#) | 260-279-1 |
| Molecular Formula | C12H22F6N6OP2 |
| MDL Number | MFCD00011948 |
| Molecular Weight | 442.28 |
| MOL File | 56602-33-6.mol |
Chemical Properties
| Appearance | white to off-white powder |
| Melting point | >130 °C (dec.)(lit.) |
| Fp | 138°C |
| storage temp. | 2-8°C |
| solubility | methanol: 25 mg/mL, clear |
| form | Powder |
| color | White to off-white |
| Water Solubility | Soluble in methanol, acetone and dichloromethane. Insoluble in water. |
| Decomposition | 138 ºC |
| Sensitive | Moisture & Light Sensitive |
| Usage | A peptide coupling reagent. Can be used in the preparation of phenyl esters of amino acids which have been shown to be valuable as blocked derivatives of amino acids in the field of peptide synthesis |
| Detection Methods | HPLC,NMR |
| BRN | 4287025 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C12H22N6OP.F6P/c1-15(2)20(16(3)4,17(5)6)19-18-12-10-8-7-9-11(12)13-14-18;1-7(2,3,4,5)6/h7-10H,1-6H3;/q+1;-1 |
| InChIKey | MGEVGECQZUIPSV-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[P+](N(C)C)(N(C)C)(N(C)C)ON1N=NC2C=CC=CC1=2 |
| CAS DataBase Reference | 56602-33-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H315-H335 |
| Precautionary statements | P210-P240-P241-P261-P264-P302+P352 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 8-10-21 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | Ⅱ |
| HS Code | 29339900 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |

