
26386-88-9
| Name | Diphenylphosphoryl azide |
| CAS | 26386-88-9 |
| EINECS(EC#) | 247-644-0 |
| Molecular Formula | C12H10N3O3P |
| MDL Number | MFCD00001987 |
| Molecular Weight | 275.2 |
| MOL File | 26386-88-9.mol |
Chemical Properties
| Appearance | Colorless to yellow liquid |
| Boiling point | 157 °C/0.17 mmHg (lit.) |
| density | 1.277 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Sparingly) |
| form | Liquid |
| color | slightly yellow |
| Specific Gravity | 1.277 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Detection Methods | GC,NMR |
| BRN | 2058967 |
| InChI | 1S/C12H10N3O3P/c13-14-15-19(16,17-11-7-3-1-4-8-11)18-12-9-5-2-6-10-12/h1-10H |
| InChIKey | SORGEQQSQGNZFI-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NP(=O)(Oc1ccccc1)Oc2ccccc2 |
| CAS DataBase Reference | 26386-88-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3278 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Toxic/Keep Cold |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29299000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

