
55750-63-5
| Name | N-Succinimidyl 6-maleimidohexanoate |
| CAS | 55750-63-5 |
| EINECS(EC#) | 637-238-5 |
| Molecular Formula | C14H16N2O6 |
| MDL Number | MFCD00043043 |
| Molecular Weight | 308.29 |
| MOL File | 55750-63-5.mol |
Chemical Properties
| Appearance | White to cream colored crystals |
| Melting point | 70-73 °C(lit.) |
| Boiling point | 480.6±47.0 °C(Predicted) |
| density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | chloroform: 100mg/mL |
| form | powder |
| pka | -2.21±0.20(Predicted) |
| color | Off-white to pale brown |
| Sensitive | Light & Moisture Sensitive & Hygroscopic |
| BRN | 1499815 |
| InChI | InChI=1S/C14H16N2O6/c17-10-5-6-11(18)15(10)9-3-1-2-4-14(21)22-16-12(19)7-8-13(16)20/h5-6H,1-4,7-9H2 |
| InChIKey | VLARLSIGSPVYHX-UHFFFAOYSA-N |
| SMILES | N1(CCCCCC(ON2C(=O)CCC2=O)=O)C(=O)C=CC1=O |
| CAS DataBase Reference | 55750-63-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
