
5551-12-2
| Name | 4-Bromo-2-nitrobenzaldehyde |
| CAS | 5551-12-2 |
| Molecular Formula | C7H4BrNO3 |
| MDL Number | MFCD00463687 |
| Molecular Weight | 230.02 |
| MOL File | 5551-12-2.mol |
Chemical Properties
| Melting point | 95.0 to 99.0 °C |
| Boiling point | 334.4±32.0 °C(Predicted) |
| density | 1.781±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| λmax | 260nm(CH3CN)(lit.) |
| InChI | InChI=1S/C7H4BrNO3/c8-6-2-1-5(4-10)7(3-6)9(11)12/h1-4H |
| InChIKey | GSXUXSXBEUJRAJ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 5551-12-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |

