
163596-75-6
| Name | 4-BROMO-3-NITRO-BENZALDEHYDE |
| CAS | 163596-75-6 |
| Molecular Formula | C7H4BrNO3 |
| MDL Number | MFCD00204031 |
| Molecular Weight | 230.02 |
| MOL File | 163596-75-6.mol |
Chemical Properties
| Melting point | 104-108 °C (lit.) |
| Boiling point | 289.3±30.0 °C(Predicted) |
| density | 1.781±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light red to Green |
| λmax | 295nm(CH3CN)(lit.) |
| InChI | InChI=1S/C7H4BrNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-4H |
| InChIKey | SAFSVELFSYQXOV-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Br)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 163596-75-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |