55-55-0
| Name | 4-Methylaminophenol sulfate |
| CAS | 55-55-0 |
| EINECS(EC#) | 200-237-1 |
| Molecular Formula | C7H11NO5S |
| MDL Number | MFCD00013140 |
| Molecular Weight | 221.23 |
| MOL File | 55-55-0.mol |
Chemical Properties
| Appearance | White crystalline powder |
| Melting point | 260 °C (dec.)(lit.) |
| density | 1.577 |
| refractive index | 1.6510 (estimate) |
| storage temp. | −20°C |
| solubility | H2O: 50 mg/mL, clear |
| form | Powder |
| color | white to faintly beige |
| PH | 3.5-4.5 (20°C, 50g/L in H2O) |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents, acids, acid halides. |
| Water Solubility | 50 g/L (20 ºC) |
| Sensitive | Air Sensitive |
| Merck | 14,6017 |
| BRN | 3919382 |
| InChI | 1S/2C7H9NO.H2O4S/c2*1-8-6-2-4-7(9)5-3-6;1-5(2,3)4/h2*2-5,8-9H,1H3;(H2,1,2,3,4) |
| Contact allergens | |
| InChIKey | ZVNPWFOVUDMGRP-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.CNc1ccc(O)cc1.CNc2ccc(O)cc2 |
| CAS DataBase Reference | 55-55-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H373-H410 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P314 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | SL8650000 |
| F | 8 |
| Autoignition Temperature | 989 °F |
| TSCA | Yes |
| REACH Registrations | Inactive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 |
| Hazardous Substances Data | 55-55-0(Hazardous Substances Data) |