| Appearance |
Rust to dark brown powder |
| Melting point |
>300°C |
| storage temp. |
Room Temperature |
| solubility |
Solubility Soluble in water, ethanol |
| Colour Index |
14270 |
| form |
Powder |
| pka |
11.5, 11.9(at 25℃) |
| color |
Rust to dark brown |
| Odor |
Odorless |
| PH |
11-13 |
| PH Range |
Yellow (11.0) to red (12.7) |
| Water Solubility |
Soluble in water and alcohol |
| λmax |
490nm |
| Merck |
14,9775 |
| BRN |
4173410 |
| Major Application |
Photoresists, image forming materials, nonlinear optical (NLO) materials, etching, photography, inks, markers, lithium battery, leather dyes, polishing stainless steel, concrete, automobile radiators, textiles, cleaners, hair dyes, food storage, cosmetics, immunomodulating agents, disinfectant, antihistaminic agent, antimicrobial agent, nucleic acids |
| Cosmetics Ingredients Functions |
COLORANT
HAIR DYEING |
| InChI |
1S/C12H10N2O5S.Na/c15-9-3-6-11(12(16)7-9)14-13-8-1-4-10(5-2-8)20(17,18)19;/h1-7,15-16H,(H,17,18,19);/q;+1/p-1/b14-13+; |
| InChIKey |
COEZWFYORILMOM-IERUDJENSA-M |
| SMILES |
[Na+].Oc1ccc(\N=N\c2ccc(cc2)S([O-])(=O)=O)c(O)c1 |
| LogP |
1.673 (est) |
| CAS DataBase Reference |
547-57-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, 4-[(2,4-dihydroxyphenyl)azo]-, monosodium salt (547-57-9) |
