54446-36-5
| Name | 4-Bromodiphenylamine |
| CAS | 54446-36-5 |
| EINECS(EC#) | 1533716-785-6 |
| Molecular Formula | C12H10BrN |
| MDL Number | MFCD07779504 |
| Molecular Weight | 248.12 |
| MOL File | 54446-36-5.mol |
Chemical Properties
| Melting point | 85-89 °C |
| Boiling point | 318°C(lit.) |
| density | 1.445±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 0.11±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H10BrN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | CCIVUDMVXNBUCY-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(Br)C=C1 |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |