4316-58-9
| Name | Tris(4-bromophenyl)amine |
| CAS | 4316-58-9 |
| EINECS(EC#) | 628-703-3 |
| Molecular Formula | C18H12Br3N |
| MDL Number | MFCD00009665 |
| Molecular Weight | 482.01 |
| MOL File | 4316-58-9.mol |
Chemical Properties
| Appearance | pale green powder |
| Melting point | 141-143 °C (lit.) |
| Boiling point | 514.9±45.0 °C(Predicted) |
| density | 1.790±0.06 g/cm3(Predicted) |
| Fp | 100°C |
| storage temp. | Refrigerator |
| solubility | Soluble in toluene. |
| form | powder to crystal |
| pka | -4.91±0.50(Predicted) |
| color | White to Almost white |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C18H12Br3N/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H |
| InChIKey | ZRXVCYGHAUGABY-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(Br)C=C2)C2=CC=C(Br)C=C2)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 4316-58-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |