
36809-26-4
| Name | 4-Bromotriphenylamine |
| CAS | 36809-26-4 |
| EINECS(EC#) | 628-532-4 |
| Molecular Formula | C18H14BrN |
| MDL Number | MFCD01851266 |
| Molecular Weight | 324.21 |
| MOL File | 36809-26-4.mol |
Chemical Properties
| Melting point | 108-112 °C (lit.) |
| Boiling point | 185 °C / 2.5mmHg |
| density | 1.369±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | -3.66±0.30(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C18H14BrN/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14H |
| InChIKey | SQTLUXJWUCHKMT-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 36809-26-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H413 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
