
5443-49-2
| Name | 2-Bromocinnamaldehyde |
| CAS | 5443-49-2 |
| EINECS(EC#) | 226-637-6 |
| Molecular Formula | C9H7BrO |
| MDL Number | MFCD00006965 |
| Molecular Weight | 211.06 |
| MOL File | 5443-49-2.mol |
Chemical Properties
| Appearance | light yellow to ochre crystalline powder |
| Melting point | 66-68 °C(lit.) |
| Boiling point | 304.4±30.0 °C(Predicted) |
| density | 1.4270 (rough estimate) |
| refractive index | 1.5720 (estimate) |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| color | Light yellow to ochre |
| Cosmetics Ingredients Functions | FRAGRANCE |
| InChI | InChI=1S/C9H7BrO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-7H |
| InChIKey | WQRWNOKNRHCLHV-UHFFFAOYSA-N |
| SMILES | C(=O)C(Br)=CC1=CC=CC=C1 |
| LogP | 2.491 (est) |
| CAS DataBase Reference | 5443-49-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenal, 2-bromo-3-phenyl-(5443-49-2) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | GD6480000 |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |