5339-85-5
| Name | 2-Aminophenethanol |
| CAS | 5339-85-5 |
| EINECS(EC#) | 226-275-9 |
| Molecular Formula | C8H11NO |
| MDL Number | MFCD00007754 |
| Molecular Weight | 137.18 |
| MOL File | 5339-85-5.mol |
Chemical Properties
| Melting point | 140-145 °C |
| Boiling point | 147-148 °C/3.5 mmHg (lit.) |
| density | 1.045 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | clear liquid |
| pka | 14.81±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C8H11NO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6,9H2 |
| InChIKey | ILDXSRFKXABMHH-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1N |
| CAS DataBase Reference | 5339-85-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneethanol, 2-amino-(5339-85-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2922190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |