529-23-7
| Name | 2-Aminobenzaldehyde |
| CAS | 529-23-7 |
| EINECS(EC#) | 208-454-3 |
| Molecular Formula | C7H7NO |
| MDL Number | MFCD00007709 |
| Molecular Weight | 121.14 |
| MOL File | 529-23-7.mol |
Chemical Properties
| Appearance | light yellow crystalline powder |
| Melting point | 38°C |
| Boiling point | 225.84°C (rough estimate) |
| density | 1.1344 (rough estimate) |
| refractive index | 1.5323 (estimate) |
| Fp | 113 °C |
| storage temp. | −20°C |
| form | Low Melting Solid |
| pka | -0.01±0.10(Predicted) |
| color | White to yellow |
| Stability: | Unstable: reported to polymerize rapidly at room temperature. Incompatible with strong oxidizing agents, strong bases. Store at-20 C. |
| InChI | InChI=1S/C7H7NO/c8-7-4-2-1-3-6(7)5-9/h1-5H,8H2 |
| InChIKey | FXWFZIRWWNPPOV-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC=C1N |
| LogP | 1.080 (est) |
| CAS DataBase Reference | 529-23-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Aminobenzaldehyde(529-23-7) |
| EPA Substance Registry System | Benzaldehyde, 2-amino- (529-23-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8-10-23 |
| TSCA | TSCA listed |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |