
52415-29-9
| Name | 6-Bromo-1H-indole |
| CAS | 52415-29-9 |
| EINECS(EC#) | 610-835-8 |
| Molecular Formula | C8H6BrN |
| MDL Number | MFCD00238550 |
| Molecular Weight | 196.04 |
| MOL File | 52415-29-9.mol |
Chemical Properties
| Appearance | White to brown powder |
| Melting point | 92-96 °C (lit.) |
| Boiling point | 70-75°C 0,01mm |
| density | 1.660±0.06 g/cm3(Predicted) |
| Fp | 70-75°C/0.01mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| pka | 16.07±0.30(Predicted) |
| color | White to brown |
| Sensitive | Air & Light Sensitive |
| BRN | 112711 |
| InChI | InChI=1S/C8H6BrN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-5,10H |
| InChIKey | MAWGHOPSCKCTPA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Br)=C2)C=C1 |
| CAS DataBase Reference | 52415-29-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
