51304-58-6
| Name | 4-CYANO-4-PHENYLPIPERIDINE HYDROCHLORIDE |
| CAS | 51304-58-6 |
| EINECS(EC#) | 257-124-5 |
| Molecular Formula | C12H15ClN2 |
| MDL Number | MFCD00012775 |
| Molecular Weight | 222.71 |
| MOL File | 51304-58-6.mol |
Chemical Properties
| Appearance | White to off-white crystalline powder |
| Melting point | 210-214 °C |
| storage temp. | Store at room temperature, keep dry and cool |
| form | Crystalline Powder |
| color | White to off-white |
| InChI | InChI=1S/C12H14N2.ClH/c13-10-12(6-8-14-9-7-12)11-4-2-1-3-5-11;/h1-5,14H,6-9H2;1H |
| InChIKey | CQPHZBOPSZGTJM-UHFFFAOYSA-N |
| SMILES | C(C1(C2C=CC=CC=2)CCNCC1)#N.Cl |
| CAS DataBase Reference | 51304-58-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |