5071-96-5
| Name | 3-Methoxybenzylamine |
| CAS | 5071-96-5 |
| EINECS(EC#) | 225-779-6 |
| Molecular Formula | C8H11NO |
| MDL Number | MFCD00008115 |
| Molecular Weight | 137.18 |
| MOL File | 5071-96-5.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Boiling point | 140 °C/37 mmHg (lit.) |
| density | 1.072 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | clear liquid |
| pka | 9.03±0.10(Predicted) |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.0720 |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1447182 |
| InChI | InChI=1S/C8H11NO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,6,9H2,1H3 |
| InChIKey | GRRIMVWABNHKBX-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=CC(OC)=C1 |
| CAS DataBase Reference | 5071-96-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methoxybenzylamine(5071-96-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| RTECS | DP5550000 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29222990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |