
49745-95-1
| Name | DOBUTAMINE HYDROCHLORIDE |
| CAS | 49745-95-1 |
| EINECS(EC#) | 256-464-1 |
| Molecular Formula | C18H24ClNO3 |
| MDL Number | MFCD00153795 |
| Molecular Weight | 337.84 |
| MOL File | 49745-95-1.mol |
Chemical Properties
| Melting point | 184-186 C |
| storage temp. | 2-8°C |
| solubility | Sparingly soluble in water, soluble in methanol, sparingly soluble in ethanol (96 per cent). |
| form | neat |
| pka | 9.45(at 25℃) |
| color | White to Off-White |
| Water Solubility | Soluble in water or ethanol with warming. Also soluble in methanol |
| λmax | 281nm(MeOH)(lit.) |
| Merck | 14,3395 |
| Stability: | Solutions are rapidly oxidized at pH 11-13. It is recommended that solutions be freshly prepared and protected from light. Dobutamine hydrochloride is sensitive to light. |
| InChI | InChI=1S/C18H23NO3.ClH/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15;/h4-9,12-13,19-22H,2-3,10-11H2,1H3;1H |
| InChIKey | BQKADKWNRWCIJL-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(CCNC(C)CCC2=CC=C(O)C=C2)C=C1O.[H]Cl |
| CAS DataBase Reference | 49745-95-1(CAS DataBase Reference) |
| EPA Substance Registry System | 49745-95-1(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H361 |
| Precautionary statements | P201-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Repr. 2 |
| Toxicity |

