59-26-7
| Name | N,N-DIETHYLNICOTINAMIDE |
| CAS | 59-26-7 |
| EINECS(EC#) | 200-418-5 |
| Molecular Formula | C10H14N2O |
| MDL Number | MFCD00006386 |
| Molecular Weight | 178.23 |
| MOL File | 59-26-7.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Melting point | 23 °C (lit.) |
| Boiling point | 296-300 °C (lit.) |
| density | 1.06 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | pKa 3.46(H2O,t =20) (Uncertain) |
| color | Clear colorless to yellow |
| Merck | 6543 |
| BRN | 5743 |
| InChI | InChI=1S/C10H14N2O/c1-3-12(4-2)10(13)9-6-5-7-11-8-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | NCYVXEGFNDZQCU-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C(N(CC)CC)=O |
| CAS DataBase Reference | 59-26-7(CAS DataBase Reference) |
| EPA Substance Registry System | Nikethamide (59-26-7) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | QS4375000 |
| REACH Registrations | Active |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333999 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 |
| Safety Profile | |
| Toxicity |