49660-57-3
| Name | 6-Bromo-2,3-dihydro-4H-chromen-4-one |
| CAS | 49660-57-3 |
| EINECS(EC#) | 663-717-3 |
| Molecular Formula | C9H7BrO2 |
| MDL Number | MFCD00546803 |
| Molecular Weight | 227.05 |
| MOL File | 49660-57-3.mol |
Chemical Properties
| Melting point | 77-83°C |
| Boiling point | 336.6±42.0 °C(Predicted) |
| density | 1.621±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C9H7BrO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| InChIKey | PFLPVOXSUCCZDH-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=C(Br)C=C2C(=O)C1 |
| CAS DataBase Reference | 49660-57-3(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
