4792-67-0
| Name | Ethyl 5-chloro-2-indolecarboxylate |
| CAS | 4792-67-0 |
| EINECS(EC#) | 225-345-6 |
| Molecular Formula | C11H10ClNO2 |
| MDL Number | MFCD00005610 |
| Molecular Weight | 223.66 |
| MOL File | 4792-67-0.mol |
Chemical Properties
| Appearance | yellowish to light brown crystalline powder |
| Melting point | 166-168 °C (lit.) |
| Boiling point | 375.0±22.0 °C(Predicted) |
| density | 1.2405 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder or Crystals |
| pka | 14.10±0.30(Predicted) |
| color | Yellow to orange to tan or light brown |
| Detection Methods | HPLC,NMR |
| BRN | 170255 |
| InChI | InChI=1S/C11H10ClNO2/c1-2-15-11(14)10-6-7-5-8(12)3-4-9(7)13-10/h3-6,13H,2H2,1H3 |
| InChIKey | LWKIFKYHCJAIAB-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C=C1C(OCC)=O |
| CAS DataBase Reference | 4792-67-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
