446-08-2
| Name | 2-Amino-5-fluorobenzoic acid |
| CAS | 446-08-2 |
| EINECS(EC#) | 207-159-7 |
| Molecular Formula | C7H6FNO2 |
| MDL Number | MFCD00055566 |
| Molecular Weight | 155.13 |
| MOL File | 446-08-2.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 181-183 °C(lit.) |
| Boiling point | 223.67°C (rough estimate) |
| density | 1.3021 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Fine Crystalline Powder |
| pka | 1.86±0.10(Predicted) |
| color | Light yellow to light brown |
| Usage | Used for the counterselection of TRP1, a commonly used genetic marker in the yeast Saccharoyces Cerevisiae. An antimetabolite for the tryptophan pathway in yeast, and is toxic by virtue of its antimetabolite conversion to 5-Fluorotryptophan. It ca |
| BRN | 2803664 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6FNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | FPQMGQZTBWIHDN-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1N |
| CAS DataBase Reference | 446-08-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29224900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
